About disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate
disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate (PubChem CID 3038497) has the molecular formula C13H19Na2O5P
and a molecular weight of 332.24 g/mol. Its IUPAC name is disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate.
Molecular Properties
| Compound Name | disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate |
| PubChem CID | 3038497 |
| Molecular Formula | C13H19Na2O5P |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate |
| SMILES | CC(C)c1cccc(C(C)C)c1OCOP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C13H21O5P.2Na/c1-9(2)11-6-5-7-12(10(3)4)13(11)17-8-18-19(14,15)16;;/h5-7,9-10H,8H2,1-4H3,(H2,14,15,16);;/q;2*+1/p-2 |
| InChIKey | LWYLQNWMSGFCOZ-UHFFFAOYSA-L |
| XLogP | -3.88 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate?
The IUPAC name of disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate (CID 3038497) is disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate.
What is the SMILES notation for disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate?
The canonical SMILES for disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate is CC(C)c1cccc(C(C)C)c1OCOP(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate?
The InChIKey is LWYLQNWMSGFCOZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H21O5P.2Na/c1-9(2)11-6-5-7-12(10(3)4)13(11)17-8-18-19(14,15)16;;/h5-7,9-10H,8H2,1-4H3,(H2,14,15,16);;/q;2*+1/p-2.
What are the key properties of disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate?
disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate has a molecular weight of 332.24 g/mol, XLogP of -3.88, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[2,6-di(propan-2-yl)phenoxy]methyl phosphate is sourced from PubChem (CID 3038497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).