C22H24N2O2 — CID 30385062
8-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]quinoline (PubChem CID 30385062) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 8-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]quinoline.
| Compound Name | 8-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 30385062 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 8-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]quinoline |
| SMILES | COc1ccc([C@H]2CCCN2Cc2cccc3cccnc23)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O2/c1-25-18-10-11-19(21(14-18)26-2)20-9-5-13-24(20)15-17-7-3-6-16-8-4-12-23-22(16)17/h3-4,6-8,10-12,14,20H,5,9,13,15H2,1-2H3/t20-/m1/s1 |
| InChIKey | TYIGXXDZVAOSNU-HXUWFJFHSA-N |
| XLogP | 4.59 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |