C27H30N4O5 — CID 3038508
5-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-5-oxopentanoic acid (PubChem CID 3038508) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is 5-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-5-oxopentanoic acid.
| Compound Name | 5-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 3038508 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 5-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-5-oxopentanoic acid |
| SMILES | Cc1c2ccnc(C(=O)NCCN(C)C)c2cc2c3cc(OC(=O)CCCC(=O)O)ccc3n(C)c12 |
| InChI | InChI=1S/C27H30N4O5/c1-16-18-10-11-28-25(27(35)29-12-13-30(2)3)20(18)15-21-19-14-17(8-9-22(19)31(4)26(16)21)36-24(34)7-5-6-23(32)33/h8-11,14-15H,5-7,12-13H2,1-4H3,(H,29,35)(H,32,33) |
| InChIKey | QQCPKTHQJNAFGC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|