C24H26N2O4S2 — CID 30385415
2-benzylsulfanyl-N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 30385415) has the molecular formula C24H26N2O4S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-benzylsulfanyl-N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 30385415 |
| Molecular Formula | C24H26N2O4S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-benzylsulfanyl-N-[2-methoxy-5-(propan-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C)cc1NC(=O)c1ccccc1SCc1ccccc1 |
| InChI | InChI=1S/C24H26N2O4S2/c1-17(2)26-32(28,29)19-13-14-22(30-3)21(15-19)25-24(27)20-11-7-8-12-23(20)31-16-18-9-5-4-6-10-18/h4-15,17,26H,16H2,1-3H3,(H,25,27) |
| InChIKey | IPCUIFYLJHKFRC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |