About methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium
methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium (PubChem CID 3038546) has the molecular formula C10H21NO6S
and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium.
Molecular Properties
| Compound Name | methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium |
| PubChem CID | 3038546 |
| Molecular Formula | C10H21NO6S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium |
| SMILES | C=CC(=O)OCC(C)[N+](C)(C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H18NO2.CH4O4S/c1-6-9(11)12-7-8(2)10(3,4)5;1-5-6(2,3)4/h6,8H,1,7H2,2-5H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | MXUSWWKXIPNEQJ-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium?
The IUPAC name of methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium (CID 3038546) is methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium.
What is the SMILES notation for methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium?
The canonical SMILES for methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium is C=CC(=O)OCC(C)[N+](C)(C)C.COS(=O)(=O)[O-].
What is the InChIKey of methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium?
The InChIKey is MXUSWWKXIPNEQJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18NO2.CH4O4S/c1-6-9(11)12-7-8(2)10(3,4)5;1-5-6(2,3)4/h6,8H,1,7H2,2-5H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium?
methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium has a molecular weight of 283.35 g/mol, XLogP of -0.10, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl sulfate;trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium is sourced from PubChem (CID 3038546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).