About N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride
N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride (PubChem CID 3038570) has the molecular formula C4H12Cl2N2Pt
and a molecular weight of 354.14 g/mol. Its IUPAC name is N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride.
Molecular Properties
| Compound Name | N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride |
| PubChem CID | 3038570 |
| Molecular Formula | C4H12Cl2N2Pt |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride |
| SMILES | CN(C)CCN.[Cl-].[Cl-].[Pt+2] |
| InChI | InChI=1S/C4H12N2.2ClH.Pt/c1-6(2)4-3-5;;;/h3-5H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ZKNXUGMERRLUKL-UHFFFAOYSA-L |
| XLogP | -6.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | -6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride?
The IUPAC name of N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride (CID 3038570) is N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride.
What is the SMILES notation for N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride?
The canonical SMILES for N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride is CN(C)CCN.[Cl-].[Cl-].[Pt+2].
What is the InChIKey of N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride?
The InChIKey is ZKNXUGMERRLUKL-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H12N2.2ClH.Pt/c1-6(2)4-3-5;;;/h3-5H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride?
N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride has a molecular weight of 354.14 g/mol, XLogP of -6.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethylethane-1,2-diamine;platinum(2+);dichloride is sourced from PubChem (CID 3038570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).