C20H23Cl2NO2 — CID 3038574
6-(2-chlorobutyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrochloride (PubChem CID 3038574) has the molecular formula C20H23Cl2NO2 and a molecular weight of 380.32 g/mol. Its IUPAC name is 6-(2-chlorobutyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrochloride.
| Compound Name | 6-(2-chlorobutyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrochloride |
|---|---|
| PubChem CID | 3038574 |
| Molecular Formula | C20H23Cl2NO2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 6-(2-chlorobutyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrochloride |
| SMILES | CCC(Cl)CN1CCc2cccc3c2C1Cc1ccc(O)c(O)c1-3.Cl |
| InChI | InChI=1S/C20H22ClNO2.ClH/c1-2-14(21)11-22-9-8-12-4-3-5-15-18(12)16(22)10-13-6-7-17(23)20(24)19(13)15;/h3-7,14,16,23-24H,2,8-11H2,1H3;1H |
| InChIKey | RPDQWEYVXVYQLT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|