About 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride
3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride (PubChem CID 3038785) has the molecular formula C11H16Cl2N2S2
and a molecular weight of 311.30 g/mol. Its IUPAC name is 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride.
Molecular Properties
| Compound Name | 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride |
| PubChem CID | 3038785 |
| Molecular Formula | C11H16Cl2N2S2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride |
| SMILES | Cl.Clc1ccc(SCCCN2CCSC2)nc1 |
| InChI | InChI=1S/C11H15ClN2S2.ClH/c12-10-2-3-11(13-8-10)16-6-1-4-14-5-7-15-9-14;/h2-3,8H,1,4-7,9H2;1H |
| InChIKey | PHJKPNBDCOWULD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride?
The IUPAC name of 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride (CID 3038785) is 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride.
What is the SMILES notation for 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride?
The canonical SMILES for 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride is Cl.Clc1ccc(SCCCN2CCSC2)nc1.
What is the InChIKey of 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride?
The InChIKey is PHJKPNBDCOWULD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2S2.ClH/c12-10-2-3-11(13-8-10)16-6-1-4-14-5-7-15-9-14;/h2-3,8H,1,4-7,9H2;1H.
What are the key properties of 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride?
3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride has a molecular weight of 311.30 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(5-chloro-2-pyridinyl)sulfanyl]propyl]-1,3-thiazolidine;hydrochloride is sourced from PubChem (CID 3038785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).