About 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride
3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride (PubChem CID 3038826) has the molecular formula C18H25Cl3N2S2
and a molecular weight of 439.91 g/mol. Its IUPAC name is 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride.
Molecular Properties
| Compound Name | 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride |
| PubChem CID | 3038826 |
| Molecular Formula | C18H25Cl3N2S2 |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride |
| SMILES | Cc1cc(SCCCCCN2CCSC2)nc2ccc(Cl)cc12.Cl.Cl |
| InChI | InChI=1S/C18H23ClN2S2.2ClH/c1-14-11-18(20-17-6-5-15(19)12-16(14)17)23-9-4-2-3-7-21-8-10-22-13-21;;/h5-6,11-12H,2-4,7-10,13H2,1H3;2*1H |
| InChIKey | XAXZRLRPMYYALI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride?
The IUPAC name of 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride (CID 3038826) is 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride.
What is the SMILES notation for 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride?
The canonical SMILES for 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride is Cc1cc(SCCCCCN2CCSC2)nc2ccc(Cl)cc12.Cl.Cl.
What is the InChIKey of 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride?
The InChIKey is XAXZRLRPMYYALI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClN2S2.2ClH/c1-14-11-18(20-17-6-5-15(19)12-16(14)17)23-9-4-2-3-7-21-8-10-22-13-21;;/h5-6,11-12H,2-4,7-10,13H2,1H3;2*1H.
What are the key properties of 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride?
3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride has a molecular weight of 439.91 g/mol, XLogP of 6.31, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(6-chloro-4-methylquinolin-2-yl)sulfanylpentyl]-1,3-thiazolidine;dihydrochloride is sourced from PubChem (CID 3038826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).