C19H24N2O3S — CID 30388969
(2R)-N-methyl-N-[(4-methylphenyl)methyl]-2-(N-methylsulfonylanilino)propanamide (PubChem CID 30388969) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is (2R)-N-methyl-N-[(4-methylphenyl)methyl]-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-methyl-N-[(4-methylphenyl)methyl]-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 30388969 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (2R)-N-methyl-N-[(4-methylphenyl)methyl]-2-(N-methylsulfonylanilino)propanamide |
| SMILES | Cc1ccc(CN(C)C(=O)[C@@H](C)N(c2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H24N2O3S/c1-15-10-12-17(13-11-15)14-20(3)19(22)16(2)21(25(4,23)24)18-8-6-5-7-9-18/h5-13,16H,14H2,1-4H3/t16-/m1/s1 |
| InChIKey | MPVURQASTHQRIY-MRXNPFEDSA-N |
| XLogP | 2.81 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |