About pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride
pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride (PubChem CID 3038985) has the molecular formula C22H22ClNO3
and a molecular weight of 383.88 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride |
| PubChem CID | 3038985 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride |
| SMILES | CCOC(C(=O)OCc1ccccn1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H21NO3.ClH/c1-2-26-22(18-11-5-3-6-12-18,19-13-7-4-8-14-19)21(24)25-17-20-15-9-10-16-23-20;/h3-16H,2,17H2,1H3;1H |
| InChIKey | DNXWPLDTINUVNU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride?
The IUPAC name of pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride (CID 3038985) is pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride.
What is the SMILES notation for pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride?
The canonical SMILES for pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride is CCOC(C(=O)OCc1ccccn1)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride?
The InChIKey is DNXWPLDTINUVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3.ClH/c1-2-26-22(18-11-5-3-6-12-18,19-13-7-4-8-14-19)21(24)25-17-20-15-9-10-16-23-20;/h3-16H,2,17H2,1H3;1H.
What are the key properties of pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride?
pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride has a molecular weight of 383.88 g/mol, XLogP of 4.53, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 2-ethoxy-2,2-diphenylacetate;hydrochloride is sourced from PubChem (CID 3038985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).