C19H23FN2O3S2 — CID 30390281
(2S)-N-(2-ethylsulfanylphenyl)-2-(4-fluoro-N-methylsulfonylanilino)butanamide (PubChem CID 30390281) has the molecular formula C19H23FN2O3S2 and a molecular weight of 410.54 g/mol. Its IUPAC name is (2S)-N-(2-ethylsulfanylphenyl)-2-(4-fluoro-N-methylsulfonylanilino)butanamide.
| Compound Name | (2S)-N-(2-ethylsulfanylphenyl)-2-(4-fluoro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 30390281 |
| Molecular Formula | C19H23FN2O3S2 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (2S)-N-(2-ethylsulfanylphenyl)-2-(4-fluoro-N-methylsulfonylanilino)butanamide |
| SMILES | CCSc1ccccc1NC(=O)[C@H](CC)N(c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H23FN2O3S2/c1-4-17(19(23)21-16-8-6-7-9-18(16)26-5-2)22(27(3,24)25)15-12-10-14(20)11-13-15/h6-13,17H,4-5H2,1-3H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | RDBUHJJCQZTGRX-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |