C13H21N5O4 — CID 3039157
N-propan-2-yl-2-[4-(2,4,6-trioxo-1,3-diazinan-1-yl)piperazin-1-yl]acetamide (PubChem CID 3039157) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-propan-2-yl-2-[4-(2,4,6-trioxo-1,3-diazinan-1-yl)piperazin-1-yl]acetamide.
| Compound Name | N-propan-2-yl-2-[4-(2,4,6-trioxo-1,3-diazinan-1-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 3039157 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-propan-2-yl-2-[4-(2,4,6-trioxo-1,3-diazinan-1-yl)piperazin-1-yl]acetamide |
| SMILES | CC(C)NC(=O)CN1CCN(N2C(=O)CC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C13H21N5O4/c1-9(2)14-11(20)8-16-3-5-17(6-4-16)18-12(21)7-10(19)15-13(18)22/h9H,3-8H2,1-2H3,(H,14,20)(H,15,19,22) |
| InChIKey | LTTYPAWSZPWJIT-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|