About (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride
(2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride (PubChem CID 3039182) has the molecular formula C13H18ClNO2
and a molecular weight of 255.75 g/mol. Its IUPAC name is (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride |
| PubChem CID | 3039182 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride |
| SMILES | CN1C[C@@](C)(O)C(=O)C[C@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C13H17NO2.ClH/c1-13(16)9-14(2)11(8-12(13)15)10-6-4-3-5-7-10;/h3-7,11,16H,8-9H2,1-2H3;1H/t11-,13+;/m0./s1 |
| InChIKey | DKHCKZZUCLCSKM-STEACBGWSA-N |
| XLogP | 1.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride?
The IUPAC name of (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride (CID 3039182) is (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride.
What is the SMILES notation for (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride?
The canonical SMILES for (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride is CN1C[C@@](C)(O)C(=O)C[C@H]1c1ccccc1.Cl.
What is the InChIKey of (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride?
The InChIKey is DKHCKZZUCLCSKM-STEACBGWSA-N. The full InChI is InChI=1S/C13H17NO2.ClH/c1-13(16)9-14(2)11(8-12(13)15)10-6-4-3-5-7-10;/h3-7,11,16H,8-9H2,1-2H3;1H/t11-,13+;/m0./s1.
What are the key properties of (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride?
(2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride has a molecular weight of 255.75 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-5-hydroxy-1,5-dimethyl-2-phenylpiperidin-4-one;hydrochloride is sourced from PubChem (CID 3039182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).