C14H18N2O — CID 3039201
(4S,4aR)-4-phenyl-4,4a,5,6,7,8-hexahydro-3H-pyrido[1,2-c][1,3]oxazin-1-imine (PubChem CID 3039201) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (4S,4aR)-4-phenyl-4,4a,5,6,7,8-hexahydro-3H-pyrido[1,2-c][1,3]oxazin-1-imine.
| Compound Name | (4S,4aR)-4-phenyl-4,4a,5,6,7,8-hexahydro-3H-pyrido[1,2-c][1,3]oxazin-1-imine |
|---|---|
| PubChem CID | 3039201 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (4S,4aR)-4-phenyl-4,4a,5,6,7,8-hexahydro-3H-pyrido[1,2-c][1,3]oxazin-1-imine |
| SMILES | [H]/N=C1\OC[C@@H](c2ccccc2)[C@H]2CCCCN12 |
| InChI | InChI=1S/C14H18N2O/c15-14-16-9-5-4-8-13(16)12(10-17-14)11-6-2-1-3-7-11/h1-3,6-7,12-13,15H,4-5,8-10H2/b15-14-/t12-,13+/m0/s1 |
| InChIKey | KOVLYXVOOXQFFR-JAZJYCRLSA-N |
| XLogP | 2.59 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|