C21H17F2NO2S — CID 30392683
N-(2,4-difluorophenyl)-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 30392683) has the molecular formula C21H17F2NO2S and a molecular weight of 385.44 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 30392683 |
| Molecular Formula | C21H17F2NO2S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1ccc(OCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17F2NO2S/c22-16-8-11-20(19(23)14-16)24-21(25)15-6-9-17(10-7-15)26-12-13-27-18-4-2-1-3-5-18/h1-11,14H,12-13H2,(H,24,25) |
| InChIKey | ATDUGPPUMXRULB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|