C28H31ClN2O3S — CID 30393057
4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-cyclohexyl-N-methylbenzamide (PubChem CID 30393057) has the molecular formula C28H31ClN2O3S and a molecular weight of 511.09 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-cyclohexyl-N-methylbenzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-cyclohexyl-N-methylbenzamide |
|---|---|
| PubChem CID | 30393057 |
| Molecular Formula | C28H31ClN2O3S |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-cyclohexyl-N-methylbenzamide |
| SMILES | Cc1ccc(Cl)cc1N(Cc1ccc(C(=O)N(C)C2CCCCC2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31ClN2O3S/c1-21-13-18-24(29)19-27(21)31(35(33,34)26-11-7-4-8-12-26)20-22-14-16-23(17-15-22)28(32)30(2)25-9-5-3-6-10-25/h4,7-8,11-19,25H,3,5-6,9-10,20H2,1-2H3 |
| InChIKey | XFANCRUFQWAWDB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |