About 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride
1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride (PubChem CID 3039349) has the molecular formula C16H21ClN6O2
and a molecular weight of 364.84 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride.
Molecular Properties
| Compound Name | 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride |
| PubChem CID | 3039349 |
| Molecular Formula | C16H21ClN6O2 |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride |
| SMILES | CN(CCn1cnc2c1c(=O)n(C)c(=O)n2C)Cc1cccnc1.Cl |
| InChI | InChI=1S/C16H20N6O2.ClH/c1-19(10-12-5-4-6-17-9-12)7-8-22-11-18-14-13(22)15(23)21(3)16(24)20(14)2;/h4-6,9,11H,7-8,10H2,1-3H3;1H |
| InChIKey | PKFJPYIUOBRNMP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 77.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride?
The IUPAC name of 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride (CID 3039349) is 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride.
What is the SMILES notation for 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride?
The canonical SMILES for 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride is CN(CCn1cnc2c1c(=O)n(C)c(=O)n2C)Cc1cccnc1.Cl.
What is the InChIKey of 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride?
The InChIKey is PKFJPYIUOBRNMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N6O2.ClH/c1-19(10-12-5-4-6-17-9-12)7-8-22-11-18-14-13(22)15(23)21(3)16(24)20(14)2;/h4-6,9,11H,7-8,10H2,1-3H3;1H.
What are the key properties of 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride?
1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride has a molecular weight of 364.84 g/mol, XLogP of 0.38, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-7-[2-[methyl(pyridin-3-ylmethyl)amino]ethyl]purine-2,6-dione;hydrochloride is sourced from PubChem (CID 3039349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).