C22H16N2O4 — CID 3039374
(2-nitrophenyl) 16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-16-carboxylate (PubChem CID 3039374) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is (2-nitrophenyl) 16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-16-carboxylate.
| Compound Name | (2-nitrophenyl) 16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-16-carboxylate |
|---|---|
| PubChem CID | 3039374 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2-nitrophenyl) 16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene-16-carboxylate |
| SMILES | O=C(Oc1ccccc1[N+](=O)[O-])N1C2Cc3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C22H16N2O4/c25-22(28-20-12-6-5-11-18(20)24(26)27)23-19-13-14-7-1-2-8-15(14)21(23)17-10-4-3-9-16(17)19/h1-12,19,21H,13H2 |
| InChIKey | NRAULKLMXWPURE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|