C17H15NO — CID 3039376
1-(16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-16-yl)ethanone (PubChem CID 3039376) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-16-yl)ethanone.
| Compound Name | 1-(16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-16-yl)ethanone |
|---|---|
| PubChem CID | 3039376 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-(16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-16-yl)ethanone |
| SMILES | CC(=O)N1C2Cc3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C17H15NO/c1-11(19)18-16-10-12-6-2-3-7-13(12)17(18)15-9-5-4-8-14(15)16/h2-9,16-17H,10H2,1H3 |
| InChIKey | RGETZHQIKNBCSQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |