C18H19Cl3N2O3S — CID 30394084
N-[(1S)-1-phenylpropyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 30394084) has the molecular formula C18H19Cl3N2O3S and a molecular weight of 449.79 g/mol. Its IUPAC name is N-[(1S)-1-phenylpropyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(1S)-1-phenylpropyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30394084 |
| Molecular Formula | C18H19Cl3N2O3S |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | N-[(1S)-1-phenylpropyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CC[C@H](NC(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C18H19Cl3N2O3S/c1-3-16(12-7-5-4-6-8-12)22-18(24)11-23(27(2,25)26)17-10-14(20)13(19)9-15(17)21/h4-10,16H,3,11H2,1-2H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | DVTBXLNUBWFUKY-INIZCTEOSA-N |
| XLogP | 4.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|