About 4-(2,3-dichloropropyl)morpholine;hydrochloride
4-(2,3-dichloropropyl)morpholine;hydrochloride (PubChem CID 3039553) has the molecular formula C7H14Cl3NO
and a molecular weight of 234.55 g/mol. Its IUPAC name is 4-(2,3-dichloropropyl)morpholine;hydrochloride.
Molecular Properties
| Compound Name | 4-(2,3-dichloropropyl)morpholine;hydrochloride |
| PubChem CID | 3039553 |
| Molecular Formula | C7H14Cl3NO |
| Molecular Weight | 234.55 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 4-(2,3-dichloropropyl)morpholine;hydrochloride |
| SMILES | Cl.ClCC(Cl)CN1CCOCC1 |
| InChI | InChI=1S/C7H13Cl2NO.ClH/c8-5-7(9)6-10-1-3-11-4-2-10;/h7H,1-6H2;1H |
| InChIKey | DBEPUGIAOXTMMQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dichloropropyl)morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dichloropropyl)morpholine;hydrochloride?
The IUPAC name of 4-(2,3-dichloropropyl)morpholine;hydrochloride (CID 3039553) is 4-(2,3-dichloropropyl)morpholine;hydrochloride.
What is the SMILES notation for 4-(2,3-dichloropropyl)morpholine;hydrochloride?
The canonical SMILES for 4-(2,3-dichloropropyl)morpholine;hydrochloride is Cl.ClCC(Cl)CN1CCOCC1.
What is the InChIKey of 4-(2,3-dichloropropyl)morpholine;hydrochloride?
The InChIKey is DBEPUGIAOXTMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Cl2NO.ClH/c8-5-7(9)6-10-1-3-11-4-2-10;/h7H,1-6H2;1H.
What are the key properties of 4-(2,3-dichloropropyl)morpholine;hydrochloride?
4-(2,3-dichloropropyl)morpholine;hydrochloride has a molecular weight of 234.55 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dichloropropyl)morpholine;hydrochloride is sourced from PubChem (CID 3039553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).