C13H17NO4S — CID 3039669
1,3-thiazolidin-3-yl-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 3039669) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 1,3-thiazolidin-3-yl-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | 1,3-thiazolidin-3-yl-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 3039669 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1,3-thiazolidin-3-yl-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCSC2)cc(OC)c1OC |
| InChI | InChI=1S/C13H17NO4S/c1-16-10-6-9(7-11(17-2)12(10)18-3)13(15)14-4-5-19-8-14/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | QVCOQCFDDPUEJZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |