About 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride
6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride (PubChem CID 3039685) has the molecular formula C16H22ClNO2
and a molecular weight of 295.81 g/mol. Its IUPAC name is 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride |
| PubChem CID | 3039685 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride |
| SMILES | CCCCC1=Cc2cc3c(cc2C1N(C)C)OCO3.Cl |
| InChI | InChI=1S/C16H21NO2.ClH/c1-4-5-6-11-7-12-8-14-15(19-10-18-14)9-13(12)16(11)17(2)3;/h7-9,16H,4-6,10H2,1-3H3;1H |
| InChIKey | ZHARNFSVAKKVFI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride?
The IUPAC name of 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride (CID 3039685) is 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride.
What is the SMILES notation for 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride?
The canonical SMILES for 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride is CCCCC1=Cc2cc3c(cc2C1N(C)C)OCO3.Cl.
What is the InChIKey of 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride?
The InChIKey is ZHARNFSVAKKVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2.ClH/c1-4-5-6-11-7-12-8-14-15(19-10-18-14)9-13(12)16(11)17(2)3;/h7-9,16H,4-6,10H2,1-3H3;1H.
What are the key properties of 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride?
6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride has a molecular weight of 295.81 g/mol, XLogP of 4.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-N,N-dimethyl-7H-cyclopenta[f][1,3]benzodioxol-7-amine;hydrochloride is sourced from PubChem (CID 3039685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).