About 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide
1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide (PubChem CID 3039706) has the molecular formula C7H13O2P
and a molecular weight of 160.15 g/mol. Its IUPAC name is 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide.
Molecular Properties
| Compound Name | 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide |
| PubChem CID | 3039706 |
| Molecular Formula | C7H13O2P |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide |
| SMILES | CC(C)OP1(=O)C=CCC1 |
| InChI | InChI=1S/C7H13O2P/c1-7(2)9-10(8)5-3-4-6-10/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | WDLKJXLGHOCZIH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide?
The IUPAC name of 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide (CID 3039706) is 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide.
What is the SMILES notation for 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide?
The canonical SMILES for 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide is CC(C)OP1(=O)C=CCC1.
What is the InChIKey of 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide?
The InChIKey is WDLKJXLGHOCZIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13O2P/c1-7(2)9-10(8)5-3-4-6-10/h3,5,7H,4,6H2,1-2H3.
What are the key properties of 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide?
1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide has a molecular weight of 160.15 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxy-2,3-dihydro-1lambda5-phosphole 1-oxide is sourced from PubChem (CID 3039706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).