C21H24N2O3S — CID 30398560
4-[methylsulfonyl(prop-2-enyl)amino]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide (PubChem CID 30398560) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-[methylsulfonyl(prop-2-enyl)amino]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide.
| Compound Name | 4-[methylsulfonyl(prop-2-enyl)amino]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 30398560 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-[methylsulfonyl(prop-2-enyl)amino]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
| SMILES | C=CCN(c1ccc(C(=O)N[C@H]2CCCc3ccccc32)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H24N2O3S/c1-3-15-23(27(2,25)26)18-13-11-17(12-14-18)21(24)22-20-10-6-8-16-7-4-5-9-19(16)20/h3-5,7,9,11-14,20H,1,6,8,10,15H2,2H3,(H,22,24)/t20-/m0/s1 |
| InChIKey | QADHTUNUAVLQHQ-FQEVSTJZSA-N |
| XLogP | 3.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|