C23H25NO4 — CID 3039888
N,N-dimethylspiro[cyclopentane-3,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-1-amine;oxalic acid (PubChem CID 3039888) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is N,N-dimethylspiro[cyclopentane-3,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-1-amine;oxalic acid.
| Compound Name | N,N-dimethylspiro[cyclopentane-3,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-1-amine;oxalic acid |
|---|---|
| PubChem CID | 3039888 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N,N-dimethylspiro[cyclopentane-3,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-1-amine;oxalic acid |
| SMILES | CN(C)C1CCC2(C1)c1ccccc1C=Cc1ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H23N.C2H2O4/c1-22(2)18-13-14-21(15-18)19-9-5-3-7-16(19)11-12-17-8-4-6-10-20(17)21;3-1(4)2(5)6/h3-12,18H,13-15H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XZZZMSXDJPZXLG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|