C17H24N2O — CID 3040009
1-[4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazin-1-yl]ethanone (PubChem CID 3040009) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 3040009 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-[4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc3c(c2)CCCCC3)CC1 |
| InChI | InChI=1S/C17H24N2O/c1-14(20)18-9-11-19(12-10-18)17-8-7-15-5-3-2-4-6-16(15)13-17/h7-8,13H,2-6,9-12H2,1H3 |
| InChIKey | SMUSWROSXDRZNJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|