About 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid
9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (PubChem CID 3040066) has the molecular formula C13H12N2O5
and a molecular weight of 276.25 g/mol. Its IUPAC name is 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid.
Molecular Properties
| Compound Name | 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| PubChem CID | 3040066 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2c(N)c3c(cc21)OCO3 |
| InChI | InChI=1S/C13H12N2O5/c1-2-15-4-6(13(17)18)11(16)9-7(15)3-8-12(10(9)14)20-5-19-8/h3-4H,2,5,14H2,1H3,(H,17,18) |
| InChIKey | DZKGUVVWZUCSJU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid?
The IUPAC name of 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (CID 3040066) is 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid.
What is the SMILES notation for 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid?
The canonical SMILES for 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid is CCn1cc(C(=O)O)c(=O)c2c(N)c3c(cc21)OCO3.
What is the InChIKey of 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid?
The InChIKey is DZKGUVVWZUCSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5/c1-2-15-4-6(13(17)18)11(16)9-7(15)3-8-12(10(9)14)20-5-19-8/h3-4H,2,5,14H2,1H3,(H,17,18).
What are the key properties of 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid?
9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid has a molecular weight of 276.25 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid is sourced from PubChem (CID 3040066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).