C15H34ClNO2 — CID 3040148
2-Propanol, 1-butoxy-3-(dibutylamino)-, hydrochloride (PubChem CID 3040148) has the molecular formula C15H34ClNO2 and a molecular weight of 295.89 g/mol. Its IUPAC name is 1-butoxy-3-(dibutylamino)propan-2-ol;hydrochloride.
| Compound Name | 2-Propanol, 1-butoxy-3-(dibutylamino)-, hydrochloride |
|---|---|
| PubChem CID | 3040148 |
| Molecular Formula | C15H34ClNO2 |
| Molecular Weight | 295.89 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-butoxy-3-(dibutylamino)propan-2-ol;hydrochloride |
| SMILES | CCCCN(CCCC)CC(COCCCC)O.Cl |
| InChI | InChI=1S/C15H33NO2.ClH/c1-4-7-10-16(11-8-5-2)13-15(17)14-18-12-9-6-3;/h15,17H,4-14H2,1-3H3;1H |
| InChIKey | AZZKJLAOJMMXPF-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 32.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | 157 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|