About [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride
[1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride (PubChem CID 3040168) has the molecular formula C21H36ClNO2S
and a molecular weight of 402.04 g/mol. Its IUPAC name is [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride.
Molecular Properties
| Compound Name | [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride |
| PubChem CID | 3040168 |
| Molecular Formula | C21H36ClNO2S |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride |
| SMILES | CCCCN(CCCC)CC(CSCCC)OC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C21H35NO2S.ClH/c1-4-7-14-22(15-8-5-2)17-20(18-25-16-6-3)24-21(23)19-12-10-9-11-13-19;/h9-13,20H,4-8,14-18H2,1-3H3;1H |
| InChIKey | GNXNYYJQMCBCBQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride?
The IUPAC name of [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride (CID 3040168) is [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride.
What is the SMILES notation for [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride?
The canonical SMILES for [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride is CCCCN(CCCC)CC(CSCCC)OC(=O)c1ccccc1.Cl.
What is the InChIKey of [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride?
The InChIKey is GNXNYYJQMCBCBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35NO2S.ClH/c1-4-7-14-22(15-8-5-2)17-20(18-25-16-6-3)24-21(23)19-12-10-9-11-13-19;/h9-13,20H,4-8,14-18H2,1-3H3;1H.
What are the key properties of [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride?
[1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride has a molecular weight of 402.04 g/mol, XLogP of 5.68, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(dibutylamino)-3-propylsulfanylpropan-2-yl] benzoate;hydrochloride is sourced from PubChem (CID 3040168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).