C15H15NO3S — CID 30402263
[(2S)-1-(benzylamino)-1-oxopropan-2-yl] thiophene-3-carboxylate (PubChem CID 30402263) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is [(2S)-1-(benzylamino)-1-oxopropan-2-yl] thiophene-3-carboxylate.
| Compound Name | [(2S)-1-(benzylamino)-1-oxopropan-2-yl] thiophene-3-carboxylate |
|---|---|
| PubChem CID | 30402263 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [(2S)-1-(benzylamino)-1-oxopropan-2-yl] thiophene-3-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccsc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H15NO3S/c1-11(19-15(18)13-7-8-20-10-13)14(17)16-9-12-5-3-2-4-6-12/h2-8,10-11H,9H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | RRTSXWSIGHELFQ-NSHDSACASA-N |
| XLogP | 2.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |