About 6-propoxypyridin-3-amine
6-propoxypyridin-3-amine (PubChem CID 3040302) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 6-propoxypyridin-3-amine.
Molecular Properties
| Compound Name | 6-propoxypyridin-3-amine |
| PubChem CID | 3040302 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 6-propoxypyridin-3-amine |
| SMILES | CCCOc1ccc(N)cn1 |
| InChI | InChI=1S/C8H12N2O/c1-2-5-11-8-4-3-7(9)6-10-8/h3-4,6H,2,5,9H2,1H3 |
| InChIKey | VVLPQYRZXQIATJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propoxypyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propoxypyridin-3-amine?
The IUPAC name of 6-propoxypyridin-3-amine (CID 3040302) is 6-propoxypyridin-3-amine.
What is the SMILES notation for 6-propoxypyridin-3-amine?
The canonical SMILES for 6-propoxypyridin-3-amine is CCCOc1ccc(N)cn1.
What is the InChIKey of 6-propoxypyridin-3-amine?
The InChIKey is VVLPQYRZXQIATJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-2-5-11-8-4-3-7(9)6-10-8/h3-4,6H,2,5,9H2,1H3.
What are the key properties of 6-propoxypyridin-3-amine?
6-propoxypyridin-3-amine has a molecular weight of 152.20 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propoxypyridin-3-amine is sourced from PubChem (CID 3040302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).