C13H17NO4 — CID 3040327
4-(2,3-dihydroxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one (PubChem CID 3040327) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 4-(2,3-dihydroxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3040327 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(2,3-dihydroxypropyl)-2,6-dimethyl-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)N(CC(O)CO)C(=O)C(C)O2 |
| InChI | InChI=1S/C13H17NO4/c1-8-3-4-12-11(5-8)14(6-10(16)7-15)13(17)9(2)18-12/h3-5,9-10,15-16H,6-7H2,1-2H3 |
| InChIKey | BDPWNNNBRBTRMF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |