C16H21NO5 — CID 3040333
4-(2,3-dihydroxypropyl)-8-methoxy-2-methyl-6-prop-2-enyl-1,4-benzoxazin-3-one (PubChem CID 3040333) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropyl)-8-methoxy-2-methyl-6-prop-2-enyl-1,4-benzoxazin-3-one.
| Compound Name | 4-(2,3-dihydroxypropyl)-8-methoxy-2-methyl-6-prop-2-enyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3040333 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-(2,3-dihydroxypropyl)-8-methoxy-2-methyl-6-prop-2-enyl-1,4-benzoxazin-3-one |
| SMILES | C=CCc1cc(OC)c2c(c1)N(CC(O)CO)C(=O)C(C)O2 |
| InChI | InChI=1S/C16H21NO5/c1-4-5-11-6-13-15(14(7-11)21-3)22-10(2)16(20)17(13)8-12(19)9-18/h4,6-7,10,12,18-19H,1,5,8-9H2,2-3H3 |
| InChIKey | ZSHDQEWJQHCKKL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|