About 1,1-dibutyl-3-ethylurea
1,1-dibutyl-3-ethylurea (PubChem CID 3040358) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,1-dibutyl-3-ethylurea.
Molecular Properties
| Compound Name | 1,1-dibutyl-3-ethylurea |
| PubChem CID | 3040358 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1,1-dibutyl-3-ethylurea |
| SMILES | CCCCN(CCCC)C(=O)NCC |
| InChI | InChI=1S/C11H24N2O/c1-4-7-9-13(10-8-5-2)11(14)12-6-3/h4-10H2,1-3H3,(H,12,14) |
| InChIKey | RIYAGGMGJVGXPG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-dibutyl-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibutyl-3-ethylurea?
The IUPAC name of 1,1-dibutyl-3-ethylurea (CID 3040358) is 1,1-dibutyl-3-ethylurea.
What is the SMILES notation for 1,1-dibutyl-3-ethylurea?
The canonical SMILES for 1,1-dibutyl-3-ethylurea is CCCCN(CCCC)C(=O)NCC.
What is the InChIKey of 1,1-dibutyl-3-ethylurea?
The InChIKey is RIYAGGMGJVGXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-4-7-9-13(10-8-5-2)11(14)12-6-3/h4-10H2,1-3H3,(H,12,14).
What are the key properties of 1,1-dibutyl-3-ethylurea?
1,1-dibutyl-3-ethylurea has a molecular weight of 200.33 g/mol, XLogP of 2.62, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibutyl-3-ethylurea is sourced from PubChem (CID 3040358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).