About 1-pyridin-2-ylpiperazine;dihydrochloride
1-pyridin-2-ylpiperazine;dihydrochloride (PubChem CID 3040476) has the molecular formula C9H15Cl2N3
and a molecular weight of 236.15 g/mol. Its IUPAC name is 1-pyridin-2-ylpiperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-pyridin-2-ylpiperazine;dihydrochloride |
| PubChem CID | 3040476 |
| Molecular Formula | C9H15Cl2N3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1-pyridin-2-ylpiperazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C9H13N3.2ClH/c1-2-4-11-9(3-1)12-7-5-10-6-8-12;;/h1-4,10H,5-8H2;2*1H |
| InChIKey | SLVHMMBZOHKYBM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyridin-2-ylpiperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-2-ylpiperazine;dihydrochloride?
The IUPAC name of 1-pyridin-2-ylpiperazine;dihydrochloride (CID 3040476) is 1-pyridin-2-ylpiperazine;dihydrochloride.
What is the SMILES notation for 1-pyridin-2-ylpiperazine;dihydrochloride?
The canonical SMILES for 1-pyridin-2-ylpiperazine;dihydrochloride is Cl.Cl.c1ccc(N2CCNCC2)nc1.
What is the InChIKey of 1-pyridin-2-ylpiperazine;dihydrochloride?
The InChIKey is SLVHMMBZOHKYBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3.2ClH/c1-2-4-11-9(3-1)12-7-5-10-6-8-12;;/h1-4,10H,5-8H2;2*1H.
What are the key properties of 1-pyridin-2-ylpiperazine;dihydrochloride?
1-pyridin-2-ylpiperazine;dihydrochloride has a molecular weight of 236.15 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-2-ylpiperazine;dihydrochloride is sourced from PubChem (CID 3040476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).