C17H27N3O7 — CID 3040498
acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 3040498) has the molecular formula C17H27N3O7 and a molecular weight of 385.42 g/mol. Its IUPAC name is acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 3040498 |
| Molecular Formula | C17H27N3O7 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | acetic acid;(2S)-6-amino-2-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | CC(=O)O.NCCCC[C@H](NC(=O)[C@@H](N)Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C15H23N3O5.C2H4O2/c16-6-2-1-3-11(15(22)23)18-14(21)10(17)7-9-4-5-12(19)13(20)8-9;1-2(3)4/h4-5,8,10-11,19-20H,1-3,6-7,16-17H2,(H,18,21)(H,22,23);1H3,(H,3,4)/t10-,11-;/m0./s1 |
| InChIKey | FTKFDUAXMMNFEF-ACMTZBLWSA-N |
| XLogP | -0.24 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|