C15H19FN2O3 — CID 30405125
N'-[(1S)-1-(4-fluorophenyl)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 30405125) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is N'-[(1S)-1-(4-fluorophenyl)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(1S)-1-(4-fluorophenyl)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 30405125 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N'-[(1S)-1-(4-fluorophenyl)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)NC[C@H]1CCCO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O3/c1-10(11-4-6-12(16)7-5-11)18-15(20)14(19)17-9-13-3-2-8-21-13/h4-7,10,13H,2-3,8-9H2,1H3,(H,17,19)(H,18,20)/t10-,13+/m0/s1 |
| InChIKey | GFSFIYIBJSPEDB-GXFFZTMASA-N |
| XLogP | 1.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|