About 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide
5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide (PubChem CID 3040567) has the molecular formula C16H33BrN2O2
and a molecular weight of 365.36 g/mol. Its IUPAC name is 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide.
Molecular Properties
| Compound Name | 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide |
| PubChem CID | 3040567 |
| Molecular Formula | C16H33BrN2O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide |
| SMILES | Br.CCC(C)N1CC(CN(CC(C)C)CC(C)C)OC1=O |
| InChI | InChI=1S/C16H32N2O2.BrH/c1-7-14(6)18-11-15(20-16(18)19)10-17(8-12(2)3)9-13(4)5;/h12-15H,7-11H2,1-6H3;1H |
| InChIKey | KVZOWFRFXWCVFH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide?
The IUPAC name of 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide (CID 3040567) is 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide.
What is the SMILES notation for 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide?
The canonical SMILES for 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide is Br.CCC(C)N1CC(CN(CC(C)C)CC(C)C)OC1=O.
What is the InChIKey of 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide?
The InChIKey is KVZOWFRFXWCVFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2.BrH/c1-7-14(6)18-11-15(20-16(18)19)10-17(8-12(2)3)9-13(4)5;/h12-15H,7-11H2,1-6H3;1H.
What are the key properties of 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide?
5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide has a molecular weight of 365.36 g/mol, XLogP of 3.80, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[bis(2-methylpropyl)amino]methyl]-3-butan-2-yl-1,3-oxazolidin-2-one;hydrobromide is sourced from PubChem (CID 3040567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).