About 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol
5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol (PubChem CID 3040604) has the molecular formula C12H10O4S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol |
| PubChem CID | 3040604 |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol |
| SMILES | Oc1cc(O)cc(Sc2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C12H10O4S/c13-7-1-8(14)4-11(3-7)17-12-5-9(15)2-10(16)6-12/h1-6,13-16H |
| InChIKey | SQOKGOOYYFKAJJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol?
The IUPAC name of 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol (CID 3040604) is 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol.
What is the SMILES notation for 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol?
The canonical SMILES for 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol is Oc1cc(O)cc(Sc2cc(O)cc(O)c2)c1.
What is the InChIKey of 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol?
The InChIKey is SQOKGOOYYFKAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4S/c13-7-1-8(14)4-11(3-7)17-12-5-9(15)2-10(16)6-12/h1-6,13-16H.
What are the key properties of 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol?
5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol has a molecular weight of 250.28 g/mol, XLogP of 2.66, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dihydroxyphenyl)sulfanylbenzene-1,3-diol is sourced from PubChem (CID 3040604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).