C32H34N4O8 — CID 3040618
acetic acid;bis[3-(2-aminoethyl)-1H-indol-5-yl] benzene-1,4-dicarboxylate (PubChem CID 3040618) has the molecular formula C32H34N4O8 and a molecular weight of 602.64 g/mol. Its IUPAC name is acetic acid;bis[3-(2-aminoethyl)-1H-indol-5-yl] benzene-1,4-dicarboxylate.
| Compound Name | acetic acid;bis[3-(2-aminoethyl)-1H-indol-5-yl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 3040618 |
| Molecular Formula | C32H34N4O8 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | acetic acid;bis[3-(2-aminoethyl)-1H-indol-5-yl] benzene-1,4-dicarboxylate |
| SMILES | CC(=O)O.CC(=O)O.NCCc1c[nH]c2ccc(OC(=O)c3ccc(C(=O)Oc4ccc5[nH]cc(CCN)c5c4)cc3)cc12 |
| InChI | InChI=1S/C28H26N4O4.2C2H4O2/c29-11-9-19-15-31-25-7-5-21(13-23(19)25)35-27(33)17-1-2-18(4-3-17)28(34)36-22-6-8-26-24(14-22)20(10-12-30)16-32-26;2*1-2(3)4/h1-8,13-16,31-32H,9-12,29-30H2;2*1H3,(H,3,4) |
| InChIKey | HBYZZMAPPKSXPF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 210.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|