About N'-pyridin-2-yloxamide
N'-pyridin-2-yloxamide (PubChem CID 3040657) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is N'-pyridin-2-yloxamide.
Molecular Properties
| Compound Name | N'-pyridin-2-yloxamide |
| PubChem CID | 3040657 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | N'-pyridin-2-yloxamide |
| SMILES | NC(=O)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C7H7N3O2/c8-6(11)7(12)10-5-3-1-2-4-9-5/h1-4H,(H2,8,11)(H,9,10,12) |
| InChIKey | VGYTTXXZHJQZQZ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-pyridin-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-pyridin-2-yloxamide?
The IUPAC name of N'-pyridin-2-yloxamide (CID 3040657) is N'-pyridin-2-yloxamide.
What is the SMILES notation for N'-pyridin-2-yloxamide?
The canonical SMILES for N'-pyridin-2-yloxamide is NC(=O)C(=O)Nc1ccccn1.
What is the InChIKey of N'-pyridin-2-yloxamide?
The InChIKey is VGYTTXXZHJQZQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c8-6(11)7(12)10-5-3-1-2-4-9-5/h1-4H,(H2,8,11)(H,9,10,12).
What are the key properties of N'-pyridin-2-yloxamide?
N'-pyridin-2-yloxamide has a molecular weight of 165.15 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-pyridin-2-yloxamide is sourced from PubChem (CID 3040657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).