About 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride
2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride (PubChem CID 3040669) has the molecular formula C21H27ClN2S
and a molecular weight of 374.98 g/mol. Its IUPAC name is 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 3040669 |
| Molecular Formula | C21H27ClN2S |
| Molecular Weight | 374.98 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride |
| SMILES | CCSc1ccc2c(c1)C(CCN(C)C)=Cc1ccccc1N2C.Cl |
| InChI | InChI=1S/C21H26N2S.ClH/c1-5-24-18-10-11-21-19(15-18)16(12-13-22(2)3)14-17-8-6-7-9-20(17)23(21)4;/h6-11,14-15H,5,12-13H2,1-4H3;1H |
| InChIKey | QOKFLNGYRYSXCP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.98 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride (CID 3040669) is 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride is CCSc1ccc2c(c1)C(CCN(C)C)=Cc1ccccc1N2C.Cl.
What is the InChIKey of 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride?
The InChIKey is QOKFLNGYRYSXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2S.ClH/c1-5-24-18-10-11-21-19(15-18)16(12-13-22(2)3)14-17-8-6-7-9-20(17)23(21)4;/h6-11,14-15H,5,12-13H2,1-4H3;1H.
What are the key properties of 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride?
2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride has a molecular weight of 374.98 g/mol, XLogP of 5.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 3040669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).