About 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine
2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine (PubChem CID 3040670) has the molecular formula C21H26N2S
and a molecular weight of 338.52 g/mol. Its IUPAC name is 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine |
| PubChem CID | 3040670 |
| Molecular Formula | C21H26N2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine |
| SMILES | CCSc1ccc2c(c1)C(CCN(C)C)=Cc1ccccc1N2C |
| InChI | InChI=1S/C21H26N2S/c1-5-24-18-10-11-21-19(15-18)16(12-13-22(2)3)14-17-8-6-7-9-20(17)23(21)4/h6-11,14-15H,5,12-13H2,1-4H3 |
| InChIKey | BMLPOIHSUCFWKS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine (CID 3040670) is 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine is CCSc1ccc2c(c1)C(CCN(C)C)=Cc1ccccc1N2C.
What is the InChIKey of 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine?
The InChIKey is BMLPOIHSUCFWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2S/c1-5-24-18-10-11-21-19(15-18)16(12-13-22(2)3)14-17-8-6-7-9-20(17)23(21)4/h6-11,14-15H,5,12-13H2,1-4H3.
What are the key properties of 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine?
2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine has a molecular weight of 338.52 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylsulfanyl-11-methylbenzo[b][1]benzazepin-5-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 3040670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).