About 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone
1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone (PubChem CID 3040867) has the molecular formula C10H12O3S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone.
Molecular Properties
| Compound Name | 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone |
| PubChem CID | 3040867 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone |
| SMILES | CCSc1ccc(C(=O)C(O)O)cc1 |
| InChI | InChI=1S/C10H12O3S/c1-2-14-8-5-3-7(4-6-8)9(11)10(12)13/h3-6,10,12-13H,2H2,1H3 |
| InChIKey | AHYWCKKAFSOVFY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone?
The IUPAC name of 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone (CID 3040867) is 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone.
What is the SMILES notation for 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone?
The canonical SMILES for 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone is CCSc1ccc(C(=O)C(O)O)cc1.
What is the InChIKey of 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone?
The InChIKey is AHYWCKKAFSOVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3S/c1-2-14-8-5-3-7(4-6-8)9(11)10(12)13/h3-6,10,12-13H,2H2,1H3.
What are the key properties of 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone?
1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone has a molecular weight of 212.27 g/mol, XLogP of 1.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylsulfanylphenyl)-2,2-dihydroxyethanone is sourced from PubChem (CID 3040867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).