C12H16O3S — CID 3040870
1-(4-butylsulfanylphenyl)-2,2-dihydroxyethanone (PubChem CID 3040870) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 1-(4-butylsulfanylphenyl)-2,2-dihydroxyethanone.
| Compound Name | 1-(4-butylsulfanylphenyl)-2,2-dihydroxyethanone |
|---|---|
| PubChem CID | 3040870 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-(4-butylsulfanylphenyl)-2,2-dihydroxyethanone |
| SMILES | CCCCSc1ccc(C(=O)C(O)O)cc1 |
| InChI | InChI=1S/C12H16O3S/c1-2-3-8-16-10-6-4-9(5-7-10)11(13)12(14)15/h4-7,12,14-15H,2-3,8H2,1H3 |
| InChIKey | MDOILPHJELYMIW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|