About 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone
1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone (PubChem CID 3040984) has the molecular formula C14H18O3S
and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone.
Molecular Properties
| Compound Name | 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone |
| PubChem CID | 3040984 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone |
| SMILES | O=C(c1ccc(SC2CCCCC2)cc1)C(O)O |
| InChI | InChI=1S/C14H18O3S/c15-13(14(16)17)10-6-8-12(9-7-10)18-11-4-2-1-3-5-11/h6-9,11,14,16-17H,1-5H2 |
| InChIKey | SBYIVOJPMIYXRE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone?
The IUPAC name of 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone (CID 3040984) is 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone.
What is the SMILES notation for 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone?
The canonical SMILES for 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone is O=C(c1ccc(SC2CCCCC2)cc1)C(O)O.
What is the InChIKey of 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone?
The InChIKey is SBYIVOJPMIYXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3S/c15-13(14(16)17)10-6-8-12(9-7-10)18-11-4-2-1-3-5-11/h6-9,11,14,16-17H,1-5H2.
What are the key properties of 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone?
1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone has a molecular weight of 266.36 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyclohexylsulfanylphenyl)-2,2-dihydroxyethanone is sourced from PubChem (CID 3040984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).