C22H26N2O5 — CID 3041122
methyl (3S,17S,21S)-3-hydroxy-6-methoxy-18-oxa-4,14-diazahexacyclo[9.9.2.01,17.04,22.05,10.014,21]docosa-5(10),6,8,11(22)-tetraene-3-carboxylate (PubChem CID 3041122) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl (3S,17S,21S)-3-hydroxy-6-methoxy-18-oxa-4,14-diazahexacyclo[9.9.2.01,17.04,22.05,10.014,21]docosa-5(10),6,8,11(22)-tetraene-3-carboxylate.
| Compound Name | methyl (3S,17S,21S)-3-hydroxy-6-methoxy-18-oxa-4,14-diazahexacyclo[9.9.2.01,17.04,22.05,10.014,21]docosa-5(10),6,8,11(22)-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 3041122 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | methyl (3S,17S,21S)-3-hydroxy-6-methoxy-18-oxa-4,14-diazahexacyclo[9.9.2.01,17.04,22.05,10.014,21]docosa-5(10),6,8,11(22)-tetraene-3-carboxylate |
| SMILES | COC(=O)[C@@]1(O)CC23CCO[C@H]2CCN2CCc4c(n1c1c(OC)cccc41)[C@@H]23 |
| InChI | InChI=1S/C22H26N2O5/c1-27-15-5-3-4-13-14-6-9-23-10-7-16-21(8-11-29-16)12-22(26,20(25)28-2)24(17(13)15)18(14)19(21)23/h3-5,16,19,26H,6-12H2,1-2H3/t16-,19+,21?,22-/m0/s1 |
| InChIKey | QDDMEOMLOUPIRE-QAWJAUKMSA-N |
| XLogP | 1.95 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |