About ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride
ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride (PubChem CID 3041125) has the molecular formula C12H18ClN5O4
and a molecular weight of 331.76 g/mol. Its IUPAC name is ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride |
| PubChem CID | 3041125 |
| Molecular Formula | C12H18ClN5O4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)Cn1c(CN)nc2c1c(=O)n(C)c(=O)n2C.Cl |
| InChI | InChI=1S/C12H17N5O4.ClH/c1-4-21-8(18)6-17-7(5-13)14-10-9(17)11(19)16(3)12(20)15(10)2;/h4-6,13H2,1-3H3;1H |
| InChIKey | OWKNIVYQQSJHCL-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride?
The IUPAC name of ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride (CID 3041125) is ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride.
What is the SMILES notation for ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride?
The canonical SMILES for ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride is CCOC(=O)Cn1c(CN)nc2c1c(=O)n(C)c(=O)n2C.Cl.
What is the InChIKey of ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride?
The InChIKey is OWKNIVYQQSJHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O4.ClH/c1-4-21-8(18)6-17-7(5-13)14-10-9(17)11(19)16(3)12(20)15(10)2;/h4-6,13H2,1-3H3;1H.
What are the key properties of ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride?
ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride has a molecular weight of 331.76 g/mol, XLogP of -1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[8-(aminomethyl)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetate;hydrochloride is sourced from PubChem (CID 3041125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).